C36H30Cl3N2O9PS — CID 57074895
2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2,2,2-trichloroethoxycarbonyloxy)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetic acid (PubChem CID 57074895) has the molecular formula C36H30Cl3N2O9PS and a molecular weight of 804.04 g/mol. Its IUPAC name is 2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2,2,2-trichloroethoxycarbonyloxy)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetic acid.
| Compound Name | 2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2,2,2-trichloroethoxycarbonyloxy)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetic acid |
|---|---|
| PubChem CID | 57074895 |
| Molecular Formula | C36H30Cl3N2O9PS |
| Molecular Weight | 804.04 g/mol |
| Exact Mass | 802.05 |
| IUPAC Name | 2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2,2,2-trichloroethoxycarbonyloxy)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetic acid |
| SMILES | O=C(COc1ccccc1)NC1C(=O)N(C(C(=O)O)=P(c2ccccc2)(c2ccccc2)c2ccccc2)C1SC(=O)COC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C36H30Cl3N2O9PS/c37-36(38,39)23-50-35(47)49-22-29(43)52-33-30(40-28(42)21-48-24-13-5-1-6-14-24)31(44)41(33)32(34(45)46)51(25-15-7-2-8-16-25,26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-20,30,33H,21-23H2,(H,40,42)(H,45,46) |
| InChIKey | IXMHMIBCPUMGOV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.04 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|