C21H19Cl3N4O6S — CID 135778761
2,2,2-trichloroethyl (4R,6R,7R)-4-(3-diazo-2-oxopropyl)-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 135778761) has the molecular formula C21H19Cl3N4O6S and a molecular weight of 561.83 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (4R,6R,7R)-4-(3-diazo-2-oxopropyl)-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (4R,6R,7R)-4-(3-diazo-2-oxopropyl)-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 135778761 |
| Molecular Formula | C21H19Cl3N4O6S |
| Molecular Weight | 561.83 g/mol |
| Exact Mass | 560.01 |
| IUPAC Name | 2,2,2-trichloroethyl (4R,6R,7R)-4-(3-diazo-2-oxopropyl)-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OCC(Cl)(Cl)Cl)N2C(=O)[C@@H](NC(=O)COc3ccccc3)[C@H]2S[C@@H]1CC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C21H19Cl3N4O6S/c1-11-14(7-12(29)8-26-25)35-19-16(27-15(30)9-33-13-5-3-2-4-6-13)18(31)28(19)17(11)20(32)34-10-21(22,23)24/h2-6,8,14,16,19H,7,9-10H2,1H3,(H,27,30)/t14-,16-,19-/m1/s1 |
| InChIKey | QBQZQLGKABSMJA-IDHHARJASA-N |
| XLogP | 2.28 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.83 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|