C26H29Cl3N2O9S — CID 18595329
(6S)-4-[2-methoxycarbonyl-3-oxo-3-(2,2,2-trichloroethoxy)propyl]-3-methyl-8-oxo-7-(5-phenoxypentanoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 18595329) has the molecular formula C26H29Cl3N2O9S and a molecular weight of 651.95 g/mol. Its IUPAC name is (6S)-4-[2-methoxycarbonyl-3-oxo-3-(2,2,2-trichloroethoxy)propyl]-3-methyl-8-oxo-7-(5-phenoxypentanoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-4-[2-methoxycarbonyl-3-oxo-3-(2,2,2-trichloroethoxy)propyl]-3-methyl-8-oxo-7-(5-phenoxypentanoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 18595329 |
| Molecular Formula | C26H29Cl3N2O9S |
| Molecular Weight | 651.95 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | (6S)-4-[2-methoxycarbonyl-3-oxo-3-(2,2,2-trichloroethoxy)propyl]-3-methyl-8-oxo-7-(5-phenoxypentanoylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COC(=O)C(CC1S[C@H]2C(NC(=O)CCCCOc3ccccc3)C(=O)N2C(C(=O)O)=C1C)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H29Cl3N2O9S/c1-14-17(12-16(24(36)38-2)25(37)40-13-26(27,28)29)41-22-19(21(33)31(22)20(14)23(34)35)30-18(32)10-6-7-11-39-15-8-4-3-5-9-15/h3-5,8-9,16-17,19,22H,6-7,10-13H2,1-2H3,(H,30,32)(H,34,35)/t16?,17?,19?,22-/m0/s1 |
| InChIKey | WHPPVSGAGPPPBW-BVJRAAQPSA-N |
| XLogP | 3.46 |
| TPSA | 148.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.95 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|