C19H18N2O4S — CID 57230372
(6S,8R,9R)-4,5-dimethyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]deca-2,4-diene-2-carboxylic acid (PubChem CID 57230372) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is (6S,8R,9R)-4,5-dimethyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]deca-2,4-diene-2-carboxylic acid.
| Compound Name | (6S,8R,9R)-4,5-dimethyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]deca-2,4-diene-2-carboxylic acid |
|---|---|
| PubChem CID | 57230372 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (6S,8R,9R)-4,5-dimethyl-10-oxo-9-[(2-phenylacetyl)amino]-7-thia-1-azatricyclo[6.2.0.03,6]deca-2,4-diene-2-carboxylic acid |
| SMILES | CC1=C(C)[C@@H]2S[C@@H]3[C@H](NC(=O)Cc4ccccc4)C(=O)N3C(C(=O)O)=C12 |
| InChI | InChI=1S/C19H18N2O4S/c1-9-10(2)16-13(9)15(19(24)25)21-17(23)14(18(21)26-16)20-12(22)8-11-6-4-3-5-7-11/h3-7,14,16,18H,8H2,1-2H3,(H,20,22)(H,24,25)/t14-,16+,18-/m1/s1 |
| InChIKey | DMFTYFSKEVDFJV-UWWQBHOKSA-N |
| XLogP | 1.69 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |