C19H16N2O5S — CID 10022896
(1R,2R,4R,5R,10S)-6-oxo-5-[(2-phenylacetyl)amino]-13-oxa-3-thia-7-azatetracyclo[8.2.1.02,9.04,7]trideca-8,11-diene-8-carboxylic acid (PubChem CID 10022896) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is (1R,2R,4R,5R,10S)-6-oxo-5-[(2-phenylacetyl)amino]-13-oxa-3-thia-7-azatetracyclo[8.2.1.02,9.04,7]trideca-8,11-diene-8-carboxylic acid.
| Compound Name | (1R,2R,4R,5R,10S)-6-oxo-5-[(2-phenylacetyl)amino]-13-oxa-3-thia-7-azatetracyclo[8.2.1.02,9.04,7]trideca-8,11-diene-8-carboxylic acid |
|---|---|
| PubChem CID | 10022896 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | (1R,2R,4R,5R,10S)-6-oxo-5-[(2-phenylacetyl)amino]-13-oxa-3-thia-7-azatetracyclo[8.2.1.02,9.04,7]trideca-8,11-diene-8-carboxylic acid |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2C(C(=O)O)=C3[C@@H]4C=C[C@@H](O4)[C@@H]3S[C@H]12 |
| InChI | InChI=1S/C19H16N2O5S/c22-12(8-9-4-2-1-3-5-9)20-14-17(23)21-15(19(24)25)13-10-6-7-11(26-10)16(13)27-18(14)21/h1-7,10-11,14,16,18H,8H2,(H,20,22)(H,24,25)/t10-,11+,14+,16-,18+/m0/s1 |
| InChIKey | KJJZKOITRHCTNW-ZAVSHWGNSA-N |
| XLogP | 0.67 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|