C16H15IN2O4S — CID 56628305
(6S,7R)-3-(iodomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 56628305) has the molecular formula C16H15IN2O4S and a molecular weight of 458.28 g/mol. Its IUPAC name is (6S,7R)-3-(iodomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S,7R)-3-(iodomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 56628305 |
| Molecular Formula | C16H15IN2O4S |
| Molecular Weight | 458.28 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | (6S,7R)-3-(iodomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2C(C(=O)O)=C(CI)CS[C@@H]12 |
| InChI | InChI=1S/C16H15IN2O4S/c17-7-10-8-24-15-12(14(21)19(15)13(10)16(22)23)18-11(20)6-9-4-2-1-3-5-9/h1-5,12,15H,6-8H2,(H,18,20)(H,22,23)/t12-,15+/m1/s1 |
| InChIKey | YOUKVPNVQSWCTL-DOMZBBRYSA-N |
| XLogP | 1.40 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|