C22H19IN2O4S — CID 174956746
phenyl 3-(iodomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 174956746) has the molecular formula C22H19IN2O4S and a molecular weight of 534.38 g/mol. Its IUPAC name is phenyl 3-(iodomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | phenyl 3-(iodomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 174956746 |
| Molecular Formula | C22H19IN2O4S |
| Molecular Weight | 534.38 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | phenyl 3-(iodomethyl)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(Cc1ccccc1)NC1C(=O)N2C(C(=O)Oc3ccccc3)=C(CI)CSC12 |
| InChI | InChI=1S/C22H19IN2O4S/c23-12-15-13-30-21-18(24-17(26)11-14-7-3-1-4-8-14)20(27)25(21)19(15)22(28)29-16-9-5-2-6-10-16/h1-10,18,21H,11-13H2,(H,24,26) |
| InChIKey | FTLSFBCRFYNMHJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|