C16H17IN2O4S2 — CID 154980024
ethyl (6R,7R)-3-(iodomethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 154980024) has the molecular formula C16H17IN2O4S2 and a molecular weight of 492.36 g/mol. Its IUPAC name is ethyl (6R,7R)-3-(iodomethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | ethyl (6R,7R)-3-(iodomethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154980024 |
| Molecular Formula | C16H17IN2O4S2 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.97 |
| IUPAC Name | ethyl (6R,7R)-3-(iodomethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(CI)CS[C@@H]2[C@H](NC(=O)Cc3cccs3)C(=O)N12 |
| InChI | InChI=1S/C16H17IN2O4S2/c1-2-23-16(22)13-9(7-17)8-25-15-12(14(21)19(13)15)18-11(20)6-10-4-3-5-24-10/h3-5,12,15H,2,6-8H2,1H3,(H,18,20)/t12-,15-/m1/s1 |
| InChIKey | WVCORDYDKBBEDT-IUODEOHRSA-N |
| XLogP | 1.94 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|