C17H17IN2O4S2 — CID 15742493
prop-2-enyl (6R,7R)-3-(iodomethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 15742493) has the molecular formula C17H17IN2O4S2 and a molecular weight of 504.37 g/mol. Its IUPAC name is prop-2-enyl (6R,7R)-3-(iodomethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | prop-2-enyl (6R,7R)-3-(iodomethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 15742493 |
| Molecular Formula | C17H17IN2O4S2 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 503.97 |
| IUPAC Name | prop-2-enyl (6R,7R)-3-(iodomethyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CCOC(=O)C1=C(CI)CS[C@@H]2[C@H](NC(=O)Cc3cccs3)C(=O)N12 |
| InChI | InChI=1S/C17H17IN2O4S2/c1-2-5-24-17(23)14-10(8-18)9-26-16-13(15(22)20(14)16)19-12(21)7-11-4-3-6-25-11/h2-4,6,13,16H,1,5,7-9H2,(H,19,21)/t13-,16-/m1/s1 |
| InChIKey | RKTUURPKFPHLSF-CZUORRHYSA-N |
| XLogP | 2.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|