C17H19IN2O3S2 — CID 156566336
(6R,7R)-3-(2-methylpropyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl iodide (PubChem CID 156566336) has the molecular formula C17H19IN2O3S2 and a molecular weight of 490.39 g/mol. Its IUPAC name is (6R,7R)-3-(2-methylpropyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl iodide.
| Compound Name | (6R,7R)-3-(2-methylpropyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl iodide |
|---|---|
| PubChem CID | 156566336 |
| Molecular Formula | C17H19IN2O3S2 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | (6R,7R)-3-(2-methylpropyl)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbonyl iodide |
| SMILES | CC(C)CC1=C(C(=O)I)N2C(=O)[C@@H](NC(=O)Cc3cccs3)[C@H]2SC1 |
| InChI | InChI=1S/C17H19IN2O3S2/c1-9(2)6-10-8-25-17-13(16(23)20(17)14(10)15(18)22)19-12(21)7-11-4-3-5-24-11/h3-5,9,13,17H,6-8H2,1-2H3,(H,19,21)/t13-,17-/m1/s1 |
| InChIKey | FIGISJDKQFKDNV-CXAGYDPISA-N |
| XLogP | 2.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|