C47H40N2O4PS+ — CID 19806617
[2-benzhydryloxycarbonyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium (PubChem CID 19806617) has the molecular formula C47H40N2O4PS+ and a molecular weight of 759.89 g/mol. Its IUPAC name is [2-benzhydryloxycarbonyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium.
| Compound Name | [2-benzhydryloxycarbonyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 19806617 |
| Molecular Formula | C47H40N2O4PS+ |
| Molecular Weight | 759.89 g/mol |
| Exact Mass | 759.24 |
| IUPAC Name | [2-benzhydryloxycarbonyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium |
| SMILES | O=C(Cc1ccccc1)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)CSC12 |
| InChI | InChI=1S/C47H39N2O4PS/c50-41(31-34-19-7-1-8-20-34)48-42-45(51)49-43(47(52)53-44(35-21-9-2-10-22-35)36-23-11-3-12-24-36)37(33-55-46(42)49)32-54(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40/h1-30,42,44,46H,31-33H2/p+1 |
| InChIKey | OOIQPSQFCZGLFG-UHFFFAOYSA-O |
| XLogP | 7.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.89 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|