C35H28N2O5S2 — CID 11050394
benzhydryl 3-benzoylsulfanyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 11050394) has the molecular formula C35H28N2O5S2 and a molecular weight of 620.75 g/mol. Its IUPAC name is benzhydryl 3-benzoylsulfanyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl 3-benzoylsulfanyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 11050394 |
| Molecular Formula | C35H28N2O5S2 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | benzhydryl 3-benzoylsulfanyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(Cc1ccccc1)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(SC(=O)c3ccccc3)CSC12 |
| InChI | InChI=1S/C35H28N2O5S2/c38-28(21-23-13-5-1-6-14-23)36-29-32(39)37-30(27(22-43-33(29)37)44-35(41)26-19-11-4-12-20-26)34(40)42-31(24-15-7-2-8-16-24)25-17-9-3-10-18-25/h1-20,29,31,33H,21-22H2,(H,36,38) |
| InChIKey | VSFQYSOIRFGTBF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|