C18H19Cl3N2O4S2 — CID 88840220
2,2,2-trichloroethyl (6R)-3,3-dimethyl-6-[(2-phenoxyacetyl)amino]-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88840220) has the molecular formula C18H19Cl3N2O4S2 and a molecular weight of 497.85 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6R)-3,3-dimethyl-6-[(2-phenoxyacetyl)amino]-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6R)-3,3-dimethyl-6-[(2-phenoxyacetyl)amino]-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88840220 |
| Molecular Formula | C18H19Cl3N2O4S2 |
| Molecular Weight | 497.85 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | 2,2,2-trichloroethyl (6R)-3,3-dimethyl-6-[(2-phenoxyacetyl)amino]-7-sulfanylidene-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)SC2[C@@H](NC(=O)COc3ccccc3)C(=S)N2C1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H19Cl3N2O4S2/c1-17(2)13(16(25)27-9-18(19,20)21)23-14(28)12(15(23)29-17)22-11(24)8-26-10-6-4-3-5-7-10/h3-7,12-13,15H,8-9H2,1-2H3,(H,22,24)/t12-,13?,15?/m0/s1 |
| InChIKey | GVAQENOKLVTYNG-OPFPJEHXSA-N |
| XLogP | 3.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|