C25H21Cl3N2O6S2 — CID 88823382
2,2,2-trichloroethyl (6R)-3-(benzoylsulfanylmethyl)-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate (PubChem CID 88823382) has the molecular formula C25H21Cl3N2O6S2 and a molecular weight of 615.94 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6R)-3-(benzoylsulfanylmethyl)-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6R)-3-(benzoylsulfanylmethyl)-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
|---|---|
| PubChem CID | 88823382 |
| Molecular Formula | C25H21Cl3N2O6S2 |
| Molecular Weight | 615.94 g/mol |
| Exact Mass | 613.99 |
| IUPAC Name | 2,2,2-trichloroethyl (6R)-3-(benzoylsulfanylmethyl)-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
| SMILES | O=C(COc1ccccc1)NC1C(=O)N2C(C(=O)OCC(Cl)(Cl)Cl)C(CSC(=O)c3ccccc3)=CS[C@H]12 |
| InChI | InChI=1S/C25H21Cl3N2O6S2/c26-25(27,28)14-36-23(33)20-16(13-38-24(34)15-7-3-1-4-8-15)12-37-22-19(21(32)30(20)22)29-18(31)11-35-17-9-5-2-6-10-17/h1-10,12,19-20,22H,11,13-14H2,(H,29,31)/t19?,20?,22-/m1/s1 |
| InChIKey | VXUGODXISBJBFX-QETWGEEDSA-N |
| XLogP | 4.20 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|