C17H15Cl3N2O5S — CID 54316830
2,2,2-trichloroethyl (6S)-3,8-dioxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 54316830) has the molecular formula C17H15Cl3N2O5S and a molecular weight of 465.74 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S)-3,8-dioxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S)-3,8-dioxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 54316830 |
| Molecular Formula | C17H15Cl3N2O5S |
| Molecular Weight | 465.74 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | 2,2,2-trichloroethyl (6S)-3,8-dioxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | O=C(Cc1ccccc1)NC1C(=O)N2C(C(=O)OCC(Cl)(Cl)Cl)C(=O)CS[C@@H]12 |
| InChI | InChI=1S/C17H15Cl3N2O5S/c18-17(19,20)8-27-16(26)13-10(23)7-28-15-12(14(25)22(13)15)21-11(24)6-9-4-2-1-3-5-9/h1-5,12-13,15H,6-8H2,(H,21,24)/t12?,13?,15-/m0/s1 |
| InChIKey | SOUQLWFWOSMCPJ-PIMMBPRGSA-N |
| XLogP | 1.48 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.74 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|