C24H22N2O6S — CID 88843256
benzhydryl (2R,6S,7R)-3,8-dioxo-7-(3-oxobutanoylamino)-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 88843256) has the molecular formula C24H22N2O6S and a molecular weight of 466.52 g/mol. Its IUPAC name is benzhydryl (2R,6S,7R)-3,8-dioxo-7-(3-oxobutanoylamino)-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | benzhydryl (2R,6S,7R)-3,8-dioxo-7-(3-oxobutanoylamino)-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 88843256 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | benzhydryl (2R,6S,7R)-3,8-dioxo-7-(3-oxobutanoylamino)-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | CC(=O)CC(=O)N[C@@H]1C(=O)N2[C@@H](C(=O)OC(c3ccccc3)c3ccccc3)C(=O)CS[C@@H]12 |
| InChI | InChI=1S/C24H22N2O6S/c1-14(27)12-18(29)25-19-22(30)26-20(17(28)13-33-23(19)26)24(31)32-21(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,19-21,23H,12-13H2,1H3,(H,25,29)/t19-,20-,23+/m1/s1 |
| InChIKey | WDHWYEBEYXOWFX-VIZSFHNOSA-N |
| XLogP | 1.64 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|