C29H23ClN2O5S — CID 54377522
benzhydryl (6S)-3-carbonochloridoyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate (PubChem CID 54377522) has the molecular formula C29H23ClN2O5S and a molecular weight of 547.03 g/mol. Its IUPAC name is benzhydryl (6S)-3-carbonochloridoyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate.
| Compound Name | benzhydryl (6S)-3-carbonochloridoyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
|---|---|
| PubChem CID | 54377522 |
| Molecular Formula | C29H23ClN2O5S |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | benzhydryl (6S)-3-carbonochloridoyl-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
| SMILES | O=C(Cc1ccccc1)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)C(C(=O)Cl)=CS[C@@H]12 |
| InChI | InChI=1S/C29H23ClN2O5S/c30-26(34)21-17-38-28-23(31-22(33)16-18-10-4-1-5-11-18)27(35)32(28)24(21)29(36)37-25(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,17,23-25,28H,16H2,(H,31,33)/t23?,24?,28-/m0/s1 |
| InChIKey | UXOWQXLXZJITFX-ZWGPAORLSA-N |
| XLogP | 3.98 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|