C28H24N2O4S2 — CID 57136407
benzhydryl (6S,7R)-8-oxo-7-[(2-phenylacetyl)amino]-3-sulfanylidene-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 57136407) has the molecular formula C28H24N2O4S2 and a molecular weight of 516.64 g/mol. Its IUPAC name is benzhydryl (6S,7R)-8-oxo-7-[(2-phenylacetyl)amino]-3-sulfanylidene-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | benzhydryl (6S,7R)-8-oxo-7-[(2-phenylacetyl)amino]-3-sulfanylidene-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 57136407 |
| Molecular Formula | C28H24N2O4S2 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | benzhydryl (6S,7R)-8-oxo-7-[(2-phenylacetyl)amino]-3-sulfanylidene-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)C(=S)CS[C@@H]12 |
| InChI | InChI=1S/C28H24N2O4S2/c31-22(16-18-10-4-1-5-11-18)29-23-26(32)30-24(21(35)17-36-27(23)30)28(33)34-25(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,23-25,27H,16-17H2,(H,29,31)/t23-,24?,27+/m1/s1 |
| InChIKey | OMGBYGQFXNTBMU-WRNLUVMSSA-N |
| XLogP | 3.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|