C28H24N2O6S — CID 90999357
benzhydryl (6R,7R)-7-[acetyl(phenoxy)amino]-3,8-dioxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 90999357) has the molecular formula C28H24N2O6S and a molecular weight of 516.58 g/mol. Its IUPAC name is benzhydryl (6R,7R)-7-[acetyl(phenoxy)amino]-3,8-dioxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-7-[acetyl(phenoxy)amino]-3,8-dioxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 90999357 |
| Molecular Formula | C28H24N2O6S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | benzhydryl (6R,7R)-7-[acetyl(phenoxy)amino]-3,8-dioxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | CC(=O)N(Oc1ccccc1)[C@@H]1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)C(=O)CS[C@H]12 |
| InChI | InChI=1S/C28H24N2O6S/c1-18(31)30(36-21-15-9-4-10-16-21)24-26(33)29-23(22(32)17-37-27(24)29)28(34)35-25(19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-16,23-25,27H,17H2,1H3/t23?,24-,27-/m1/s1 |
| InChIKey | NWWVDSTZKREKPK-XBAMXDLOSA-N |
| XLogP | 3.38 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|