C28H28N2O6S2 — CID 22821816
benzhydryl (6S)-7-amino-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 22821816) has the molecular formula C28H28N2O6S2 and a molecular weight of 552.67 g/mol. Its IUPAC name is benzhydryl (6S)-7-amino-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | benzhydryl (6S)-7-amino-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 22821816 |
| Molecular Formula | C28H28N2O6S2 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | benzhydryl (6S)-7-amino-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | C=C1CS[C@H]2C(N)C(=O)N2C1C(=O)OC(c1ccccc1)c1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C21H20N2O3S.C7H8O3S/c1-13-12-27-20-16(22)19(24)23(20)17(13)21(25)26-18(14-8-4-2-5-9-14)15-10-6-3-7-11-15;1-6-2-4-7(5-3-6)11(8,9)10/h2-11,16-18,20H,1,12,22H2;2-5H,1H3,(H,8,9,10)/t16?,17?,20-;/m0./s1 |
| InChIKey | RVLMJANBGUQISK-KQAKAMLZSA-N |
| XLogP | 3.73 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|