C33H38N2O7S2 — CID 88788808
benzhydryl (6R,7R)-7-amino-8-oxo-3-(pentoxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 88788808) has the molecular formula C33H38N2O7S2 and a molecular weight of 638.81 g/mol. Its IUPAC name is benzhydryl (6R,7R)-7-amino-8-oxo-3-(pentoxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | benzhydryl (6R,7R)-7-amino-8-oxo-3-(pentoxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88788808 |
| Molecular Formula | C33H38N2O7S2 |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | benzhydryl (6R,7R)-7-amino-8-oxo-3-(pentoxymethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | CCCCCOCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@H](N)[C@H]2SC1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C26H30N2O4S.C7H8O3S/c1-2-3-10-15-31-16-20-17-33-25-21(27)24(29)28(25)22(20)26(30)32-23(18-11-6-4-7-12-18)19-13-8-5-9-14-19;1-6-2-4-7(5-3-6)11(8,9)10/h4-9,11-14,21,23,25H,2-3,10,15-17,27H2,1H3;2-5H,1H3,(H,8,9,10)/t21-,25-;/m1./s1 |
| InChIKey | CSPUUHNPFAFPTE-UPWLLONGSA-N |
| XLogP | 5.26 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|