C23H26N2O7S2 — CID 22790809
(4-methoxyphenyl)methyl (6S)-7-amino-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 22790809) has the molecular formula C23H26N2O7S2 and a molecular weight of 506.60 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (6S)-7-amino-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | (4-methoxyphenyl)methyl (6S)-7-amino-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 22790809 |
| Molecular Formula | C23H26N2O7S2 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | (4-methoxyphenyl)methyl (6S)-7-amino-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | C=C1CS[C@H]2C(N)C(=O)N2C1C(=O)OCc1ccc(OC)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H18N2O4S.C7H8O3S/c1-9-8-23-15-12(17)14(19)18(15)13(9)16(20)22-7-10-3-5-11(21-2)6-4-10;1-6-2-4-7(5-3-6)11(8,9)10/h3-6,12-13,15H,1,7-8,17H2,2H3;2-5H,1H3,(H,8,9,10)/t12?,13?,15-;/m0./s1 |
| InChIKey | RJHVZQMCMZSWEQ-ALFLHYLISA-N |
| XLogP | 2.15 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|