C19H21ClN2O6S — CID 22798930
(4-methoxyphenyl)methyl (6S)-7-[(2-chloroacetyl)amino]-7-methoxy-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 22798930) has the molecular formula C19H21ClN2O6S and a molecular weight of 440.91 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (6S)-7-[(2-chloroacetyl)amino]-7-methoxy-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (6S)-7-[(2-chloroacetyl)amino]-7-methoxy-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 22798930 |
| Molecular Formula | C19H21ClN2O6S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (4-methoxyphenyl)methyl (6S)-7-[(2-chloroacetyl)amino]-7-methoxy-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C=C1CS[C@@H]2N(C(=O)C2(NC(=O)CCl)OC)C1C(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H21ClN2O6S/c1-11-10-29-18-19(27-3,21-14(23)8-20)17(25)22(18)15(11)16(24)28-9-12-4-6-13(26-2)7-5-12/h4-7,15,18H,1,8-10H2,2-3H3,(H,21,23)/t15?,18-,19?/m0/s1 |
| InChIKey | KXYLJQIJGRHGIA-OBONGRFPSA-N |
| XLogP | 1.28 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|