C24H24ClN5O7S2 — CID 87970031
(4-methoxyphenyl)methyl (6S,7R)-7-[[2-[[(2-chloroacetyl)amino]-(1,3-thiazol-4-yl)methoxy]iminoacetyl]amino]-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 87970031) has the molecular formula C24H24ClN5O7S2 and a molecular weight of 594.07 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (6S,7R)-7-[[2-[[(2-chloroacetyl)amino]-(1,3-thiazol-4-yl)methoxy]iminoacetyl]amino]-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (6S,7R)-7-[[2-[[(2-chloroacetyl)amino]-(1,3-thiazol-4-yl)methoxy]iminoacetyl]amino]-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 87970031 |
| Molecular Formula | C24H24ClN5O7S2 |
| Molecular Weight | 594.07 g/mol |
| Exact Mass | 593.08 |
| IUPAC Name | (4-methoxyphenyl)methyl (6S,7R)-7-[[2-[[(2-chloroacetyl)amino]-(1,3-thiazol-4-yl)methoxy]iminoacetyl]amino]-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C=C1CS[C@H]2[C@H](NC(=O)C=NOC(NC(=O)CCl)c3cscn3)C(=O)N2C1C(=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H24ClN5O7S2/c1-13-10-39-23-19(28-18(32)8-27-37-21(29-17(31)7-25)16-11-38-12-26-16)22(33)30(23)20(13)24(34)36-9-14-3-5-15(35-2)6-4-14/h3-6,8,11-12,19-21,23H,1,7,9-10H2,2H3,(H,28,32)(H,29,31)/t19-,20?,21?,23+/m1/s1 |
| InChIKey | UOFOERSAVDERAB-QURIUFGUSA-N |
| XLogP | 1.58 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.07 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|