C18H20N2O6S — CID 70636841
(6R)-7-methoxy-7-[[2-(4-methoxyphenyl)acetyl]amino]-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid (PubChem CID 70636841) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is (6R)-7-methoxy-7-[[2-(4-methoxyphenyl)acetyl]amino]-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid.
| Compound Name | (6R)-7-methoxy-7-[[2-(4-methoxyphenyl)acetyl]amino]-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 70636841 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (6R)-7-methoxy-7-[[2-(4-methoxyphenyl)acetyl]amino]-3-methylidene-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
| SMILES | C=C1CS[C@H]2N(C(=O)C2(NC(=O)Cc2ccc(OC)cc2)OC)C1C(=O)O |
| InChI | InChI=1S/C18H20N2O6S/c1-10-9-27-17-18(26-3,16(24)20(17)14(10)15(22)23)19-13(21)8-11-4-6-12(25-2)7-5-11/h4-7,14,17H,1,8-9H2,2-3H3,(H,19,21)(H,22,23)/t14?,17-,18?/m1/s1 |
| InChIKey | MYRLUMFQHPDIHR-ZCDVPAHGSA-N |
| XLogP | 0.62 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|