C28H24N2O6S2 — CID 88819155
benzhydryl (6R)-3-formyl-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate (PubChem CID 88819155) has the molecular formula C28H24N2O6S2 and a molecular weight of 548.64 g/mol. Its IUPAC name is benzhydryl (6R)-3-formyl-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-formyl-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
|---|---|
| PubChem CID | 88819155 |
| Molecular Formula | C28H24N2O6S2 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | benzhydryl (6R)-3-formyl-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
| SMILES | COC1(NC(=O)Cc2cccs2)C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)C(C=O)=CS[C@@H]21 |
| InChI | InChI=1S/C28H24N2O6S2/c1-35-28(29-22(32)15-21-13-8-14-37-21)26(34)30-23(20(16-31)17-38-27(28)30)25(33)36-24(18-9-4-2-5-10-18)19-11-6-3-7-12-19/h2-14,16-17,23-24,27H,15H2,1H3,(H,29,32)/t23?,27-,28?/m1/s1 |
| InChIKey | YMDAACDANMEWHD-OXOHJMPHSA-N |
| XLogP | 3.45 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|