C15H16N2O5S2 — CID 70637460
(6R)-7-methoxy-3-methylidene-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid (PubChem CID 70637460) has the molecular formula C15H16N2O5S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (6R)-7-methoxy-3-methylidene-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid.
| Compound Name | (6R)-7-methoxy-3-methylidene-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 70637460 |
| Molecular Formula | C15H16N2O5S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (6R)-7-methoxy-3-methylidene-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylic acid |
| SMILES | C=C1CS[C@H]2N(C(=O)C2(NC(=O)Cc2cccs2)OC)C1C(=O)O |
| InChI | InChI=1S/C15H16N2O5S2/c1-8-7-24-14-15(22-2,13(21)17(14)11(8)12(19)20)16-10(18)6-9-4-3-5-23-9/h3-5,11,14H,1,6-7H2,2H3,(H,16,18)(H,19,20)/t11?,14-,15?/m1/s1 |
| InChIKey | MDWPQSNHVADSMO-XGTXGMFGSA-N |
| XLogP | 0.67 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|