C16H17N3O6S3 — CID 88738216
(6R)-3-(carbamoylsulfanylmethyl)-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88738216) has the molecular formula C16H17N3O6S3 and a molecular weight of 443.53 g/mol. Its IUPAC name is (6R)-3-(carbamoylsulfanylmethyl)-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-(carbamoylsulfanylmethyl)-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88738216 |
| Molecular Formula | C16H17N3O6S3 |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | (6R)-3-(carbamoylsulfanylmethyl)-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COC1(NC(=O)Cc2cccs2)C(=O)N2C(C(=O)O)=C(CSC(N)=O)CS[C@@H]21 |
| InChI | InChI=1S/C16H17N3O6S3/c1-25-16(18-10(20)5-9-3-2-4-26-9)13(23)19-11(12(21)22)8(6-27-14(16)19)7-28-15(17)24/h2-4,14H,5-7H2,1H3,(H2,17,24)(H,18,20)(H,21,22)/t14-,16?/m1/s1 |
| InChIKey | CLTUNYJKHGJECM-IURRXHLWSA-N |
| XLogP | 0.82 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|