C18H19BrN2O7S2 — CID 70543291
(6R,7R)-3-(acetyloxymethyl)-7-(2-bromoethoxy)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 70543291) has the molecular formula C18H19BrN2O7S2 and a molecular weight of 519.40 g/mol. Its IUPAC name is (6R,7R)-3-(acetyloxymethyl)-7-(2-bromoethoxy)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-(acetyloxymethyl)-7-(2-bromoethoxy)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70543291 |
| Molecular Formula | C18H19BrN2O7S2 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | (6R,7R)-3-(acetyloxymethyl)-7-(2-bromoethoxy)-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@@](NC(=O)Cc3cccs3)(OCCBr)[C@H]2SC1 |
| InChI | InChI=1S/C18H19BrN2O7S2/c1-10(22)27-8-11-9-30-17-18(28-5-4-19,16(26)21(17)14(11)15(24)25)20-13(23)7-12-3-2-6-29-12/h2-3,6,17H,4-5,7-9H2,1H3,(H,20,23)(H,24,25)/t17-,18-/m1/s1 |
| InChIKey | JXBNOUGOKFZETM-QZTJIDSGSA-N |
| XLogP | 1.33 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|