C16H17N2Na2O8PS2 — CID 70636389
disodium;[(6S,7S)-7-methoxy-8-oxo-2-phosphonato-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate (PubChem CID 70636389) has the molecular formula C16H17N2Na2O8PS2 and a molecular weight of 506.41 g/mol. Its IUPAC name is disodium;[(6S,7S)-7-methoxy-8-oxo-2-phosphonato-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate.
| Compound Name | disodium;[(6S,7S)-7-methoxy-8-oxo-2-phosphonato-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate |
|---|---|
| PubChem CID | 70636389 |
| Molecular Formula | C16H17N2Na2O8PS2 |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.00 |
| IUPAC Name | disodium;[(6S,7S)-7-methoxy-8-oxo-2-phosphonato-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate |
| SMILES | CO[C@@]1(NC(=O)Cc2cccs2)C(=O)N2C(P(=O)([O-])[O-])=C(COC(C)=O)CS[C@H]21.[Na+].[Na+] |
| InChI | InChI=1S/C16H19N2O8PS2.2Na/c1-9(19)26-7-10-8-29-15-16(25-2,14(21)18(15)13(10)27(22,23)24)17-12(20)6-11-4-3-5-28-11;;/h3-5,15H,6-8H2,1-2H3,(H,17,20)(H2,22,23,24);;/q;2*+1/p-2/t15-,16-;;/m0../s1 |
| InChIKey | VDYBSOOTQITILK-SXBSVMRRSA-L |
| XLogP | -6.64 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | -6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|