C22H19N2NaO9S2 — CID 67861222
sodium (6R,7R)-3-[(3,4-dihydroxybenzoyl)oxymethyl]-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 67861222) has the molecular formula C22H19N2NaO9S2 and a molecular weight of 542.52 g/mol. Its IUPAC name is sodium (6R,7R)-3-[(3,4-dihydroxybenzoyl)oxymethyl]-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | sodium (6R,7R)-3-[(3,4-dihydroxybenzoyl)oxymethyl]-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 67861222 |
| Molecular Formula | C22H19N2NaO9S2 |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | sodium (6R,7R)-3-[(3,4-dihydroxybenzoyl)oxymethyl]-7-methoxy-8-oxo-7-[(2-thiophen-2-ylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO[C@]1(NC(=O)Cc2cccs2)C(=O)N2C(C(=O)[O-])=C(COC(=O)c3ccc(O)c(O)c3)CS[C@@H]21.[Na+] |
| InChI | InChI=1S/C22H20N2O9S2.Na/c1-32-22(23-16(27)8-13-3-2-6-34-13)20(31)24-17(18(28)29)12(10-35-21(22)24)9-33-19(30)11-4-5-14(25)15(26)7-11;/h2-7,21,25-26H,8-10H2,1H3,(H,23,27)(H,28,29);/q;+1/p-1/t21-,22-;/m1./s1 |
| InChIKey | SXTWLEJVEYAMTO-HLUKFBSCSA-M |
| XLogP | -3.06 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|