C22H26N2O7S — CID 22794646
(6R,7S)-3-(acetyloxymethyl)-7-butoxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22794646) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is (6R,7S)-3-(acetyloxymethyl)-7-butoxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-3-(acetyloxymethyl)-7-butoxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22794646 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (6R,7S)-3-(acetyloxymethyl)-7-butoxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCCO[C@@]1(NC(=O)Cc2ccccc2)C(=O)N2C(C(=O)O)=C(COC(C)=O)CS[C@@H]21 |
| InChI | InChI=1S/C22H26N2O7S/c1-3-4-10-31-22(23-17(26)11-15-8-6-5-7-9-15)20(29)24-18(19(27)28)16(12-30-14(2)25)13-32-21(22)24/h5-9,21H,3-4,10-13H2,1-2H3,(H,23,26)(H,27,28)/t21-,22+/m1/s1 |
| InChIKey | QHOWYDANXSXQSX-YADHBBJMSA-N |
| XLogP | 1.68 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|