C16H15Cl2N5O6S2 — CID 90892050
(6S)-7-[[2-[[(2-chloroacetyl)amino]-(1,3-thiazol-4-yl)methoxy]iminoacetyl]amino]-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 90892050) has the molecular formula C16H15Cl2N5O6S2 and a molecular weight of 508.37 g/mol. Its IUPAC name is (6S)-7-[[2-[[(2-chloroacetyl)amino]-(1,3-thiazol-4-yl)methoxy]iminoacetyl]amino]-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-[[(2-chloroacetyl)amino]-(1,3-thiazol-4-yl)methoxy]iminoacetyl]amino]-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 90892050 |
| Molecular Formula | C16H15Cl2N5O6S2 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 506.98 |
| IUPAC Name | (6S)-7-[[2-[[(2-chloroacetyl)amino]-(1,3-thiazol-4-yl)methoxy]iminoacetyl]amino]-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(C=NOC(NC(=O)CCl)c1cscn1)NC1C(=O)N2C(C(=O)O)=C(CCl)CS[C@@H]12 |
| InChI | InChI=1S/C16H15Cl2N5O6S2/c17-1-7-4-31-15-11(14(26)23(15)12(7)16(27)28)21-10(25)3-20-29-13(22-9(24)2-18)8-5-30-6-19-8/h3,5-6,11,13,15H,1-2,4H2,(H,21,25)(H,22,24)(H,27,28)/t11?,13?,15-/m0/s1 |
| InChIKey | SBPVZSXQJJTEQO-HGMXIMQMSA-N |
| XLogP | 0.48 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|