C18H15Cl3N2O5S — CID 88836509
2,2,2-trichloroethyl (6R)-8-oxo-3-(oxomethylidene)-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 88836509) has the molecular formula C18H15Cl3N2O5S and a molecular weight of 477.75 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6R)-8-oxo-3-(oxomethylidene)-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6R)-8-oxo-3-(oxomethylidene)-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 88836509 |
| Molecular Formula | C18H15Cl3N2O5S |
| Molecular Weight | 477.75 g/mol |
| Exact Mass | 475.98 |
| IUPAC Name | 2,2,2-trichloroethyl (6R)-8-oxo-3-(oxomethylidene)-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | O=C=C1CS[C@@H]2C(NC(=O)Cc3ccccc3)C(=O)N2C1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H15Cl3N2O5S/c19-18(20,21)9-28-17(27)14-11(7-24)8-29-16-13(15(26)23(14)16)22-12(25)6-10-4-2-1-3-5-10/h1-5,13-14,16H,6,8-9H2,(H,22,25)/t13?,14?,16-/m1/s1 |
| InChIKey | NYIJBJCDHXPJGT-ZBCRRDGASA-N |
| XLogP | 1.67 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|