C16H17ClN2O6S — CID 88750825
methyl 2-[(2R,3R)-2-acetylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-chloroacetate (PubChem CID 88750825) has the molecular formula C16H17ClN2O6S and a molecular weight of 400.84 g/mol. Its IUPAC name is methyl 2-[(2R,3R)-2-acetylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-chloroacetate.
| Compound Name | methyl 2-[(2R,3R)-2-acetylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-chloroacetate |
|---|---|
| PubChem CID | 88750825 |
| Molecular Formula | C16H17ClN2O6S |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | methyl 2-[(2R,3R)-2-acetylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-chloroacetate |
| SMILES | COC(=O)C(Cl)N1C(=O)[C@@H](NC(=O)COc2ccccc2)[C@H]1SC(C)=O |
| InChI | InChI=1S/C16H17ClN2O6S/c1-9(20)26-15-12(14(22)19(15)13(17)16(23)24-2)18-11(21)8-25-10-6-4-3-5-7-10/h3-7,12-13,15H,8H2,1-2H3,(H,18,21)/t12-,13?,15-/m1/s1 |
| InChIKey | RPMRLJJZRRLAHK-ILWWEHDPSA-N |
| XLogP | 0.74 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|