C29H28N2O6S — CID 13424498
1-(1-benzhydryloxy-3-methyl-1-oxobut-2-en-2-yl)-3-[(4-methylbenzoyl)amino]-4-oxoazetidine-2-sulfinic acid (PubChem CID 13424498) has the molecular formula C29H28N2O6S and a molecular weight of 532.62 g/mol. Its IUPAC name is 1-(1-benzhydryloxy-3-methyl-1-oxobut-2-en-2-yl)-3-[(4-methylbenzoyl)amino]-4-oxoazetidine-2-sulfinic acid.
| Compound Name | 1-(1-benzhydryloxy-3-methyl-1-oxobut-2-en-2-yl)-3-[(4-methylbenzoyl)amino]-4-oxoazetidine-2-sulfinic acid |
|---|---|
| PubChem CID | 13424498 |
| Molecular Formula | C29H28N2O6S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 1-(1-benzhydryloxy-3-methyl-1-oxobut-2-en-2-yl)-3-[(4-methylbenzoyl)amino]-4-oxoazetidine-2-sulfinic acid |
| SMILES | CC(C)=C(C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)C(NC(=O)c2ccc(C)cc2)C1S(=O)O |
| InChI | InChI=1S/C29H28N2O6S/c1-18(2)24(29(34)37-25(20-10-6-4-7-11-20)21-12-8-5-9-13-21)31-27(33)23(28(31)38(35)36)30-26(32)22-16-14-19(3)15-17-22/h4-17,23,25,28H,1-3H3,(H,30,32)(H,35,36) |
| InChIKey | BUWDXFRRAVZWBH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|