C33H32N2O6 — CID 88677094
benzhydryl 2-[(3S,4S)-3-methoxy-2-oxo-3-[(2-phenylacetyl)amino]-4-prop-2-ynoxyazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 88677094) has the molecular formula C33H32N2O6 and a molecular weight of 552.63 g/mol. Its IUPAC name is benzhydryl 2-[(3S,4S)-3-methoxy-2-oxo-3-[(2-phenylacetyl)amino]-4-prop-2-ynoxyazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | benzhydryl 2-[(3S,4S)-3-methoxy-2-oxo-3-[(2-phenylacetyl)amino]-4-prop-2-ynoxyazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 88677094 |
| Molecular Formula | C33H32N2O6 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | benzhydryl 2-[(3S,4S)-3-methoxy-2-oxo-3-[(2-phenylacetyl)amino]-4-prop-2-ynoxyazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | C#CCO[C@@H]1N(C(C(=O)OC(c2ccccc2)c2ccccc2)=C(C)C)C(=O)[C@@]1(NC(=O)Cc1ccccc1)OC |
| InChI | InChI=1S/C33H32N2O6/c1-5-21-40-32-33(39-4,34-27(36)22-24-15-9-6-10-16-24)31(38)35(32)28(23(2)3)30(37)41-29(25-17-11-7-12-18-25)26-19-13-8-14-20-26/h1,6-20,29,32H,21-22H2,2-4H3,(H,34,36)/t32-,33+/m0/s1 |
| InChIKey | HZPOXONASGDNOA-JHOUSYSJSA-N |
| XLogP | 4.13 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|