C26H22N2O6 — CID 88677162
benzyl 2-[(3R,4R)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-prop-2-ynoxyazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 88677162) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is benzyl 2-[(3R,4R)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-prop-2-ynoxyazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | benzyl 2-[(3R,4R)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-prop-2-ynoxyazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 88677162 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | benzyl 2-[(3R,4R)-3-(1,3-dioxoisoindol-2-yl)-2-oxo-4-prop-2-ynoxyazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | C#CCO[C@@H]1[C@@H](N2C(=O)c3ccccc3C2=O)C(=O)N1C(C(=O)OCc1ccccc1)=C(C)C |
| InChI | InChI=1S/C26H22N2O6/c1-4-14-33-25-21(27-22(29)18-12-8-9-13-19(18)23(27)30)24(31)28(25)20(16(2)3)26(32)34-15-17-10-6-5-7-11-17/h1,5-13,21,25H,14-15H2,2-3H3/t21-,25+/m0/s1 |
| InChIKey | NUIBSJSBUBXUTP-SQJMNOBHSA-N |
| XLogP | 2.51 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|