C24H20N4O13S — CID 173389796
(4-nitrophenyl)methyl 3-hydroxy-2-[(2S,3S)-2-[hydroxy(methylsulfonyl)methyl]-3-(5-nitro-1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]but-2-enoate (PubChem CID 173389796) has the molecular formula C24H20N4O13S and a molecular weight of 604.51 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-hydroxy-2-[(2S,3S)-2-[hydroxy(methylsulfonyl)methyl]-3-(5-nitro-1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]but-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 3-hydroxy-2-[(2S,3S)-2-[hydroxy(methylsulfonyl)methyl]-3-(5-nitro-1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 173389796 |
| Molecular Formula | C24H20N4O13S |
| Molecular Weight | 604.51 g/mol |
| Exact Mass | 604.07 |
| IUPAC Name | (4-nitrophenyl)methyl 3-hydroxy-2-[(2S,3S)-2-[hydroxy(methylsulfonyl)methyl]-3-(5-nitro-1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]but-2-enoate |
| SMILES | CC(O)=C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)[C@@H](N2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)[C@H]1C(O)S(C)(=O)=O |
| InChI | InChI=1S/C24H20N4O13S/c1-11(29)17(23(33)41-10-12-3-5-13(6-4-12)27(35)36)25-19(24(34)42(2,39)40)18(22(25)32)26-20(30)15-8-7-14(28(37)38)9-16(15)21(26)31/h3-9,18-19,24,29,34H,10H2,1-2H3/t18-,19-,24?/m0/s1 |
| InChIKey | ZZXVEHXOUKZGOC-QHEXFSSWSA-N |
| XLogP | 0.57 |
| TPSA | 244.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.51 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|