C23H19Br2N3O7S — CID 20534619
(4-nitrophenyl)methyl 2-[2-bromo-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]-3-bromosulfanyl-3-methylbutanoate (PubChem CID 20534619) has the molecular formula C23H19Br2N3O7S and a molecular weight of 641.29 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[2-bromo-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]-3-bromosulfanyl-3-methylbutanoate.
| Compound Name | (4-nitrophenyl)methyl 2-[2-bromo-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]-3-bromosulfanyl-3-methylbutanoate |
|---|---|
| PubChem CID | 20534619 |
| Molecular Formula | C23H19Br2N3O7S |
| Molecular Weight | 641.29 g/mol |
| Exact Mass | 638.93 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[2-bromo-3-(1,3-dioxoisoindol-2-yl)-4-oxoazetidin-1-yl]-3-bromosulfanyl-3-methylbutanoate |
| SMILES | CC(C)(SBr)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(N2C(=O)c3ccccc3C2=O)C1Br |
| InChI | InChI=1S/C23H19Br2N3O7S/c1-23(2,36-25)17(22(32)35-11-12-7-9-13(10-8-12)28(33)34)27-18(24)16(21(27)31)26-19(29)14-5-3-4-6-15(14)20(26)30/h3-10,16-18H,11H2,1-2H3 |
| InChIKey | ORPQRTDIXPJJGA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|