C17H12N2O6 — CID 800656
(4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 800656) has the molecular formula C17H12N2O6 and a molecular weight of 340.29 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 800656 |
| Molecular Formula | C17H12N2O6 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12N2O6/c20-15(25-10-11-5-7-12(8-6-11)19(23)24)9-18-16(21)13-3-1-2-4-14(13)17(18)22/h1-8H,9-10H2 |
| InChIKey | LMNTVRZNWHUEIT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|