C20H17N3O6 — CID 9136770
(4-nitrophenyl)methyl 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetate (PubChem CID 9136770) has the molecular formula C20H17N3O6 and a molecular weight of 395.37 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetate.
| Compound Name | (4-nitrophenyl)methyl 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 9136770 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetate |
| SMILES | O=C(Cn1c(=O)ccn(Cc2ccccc2)c1=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H17N3O6/c24-18-10-11-21(12-15-4-2-1-3-5-15)20(26)22(18)13-19(25)29-14-16-6-8-17(9-7-16)23(27)28/h1-11H,12-14H2 |
| InChIKey | SFOCITLKTSYAJI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 113.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|