C24H20N2O4 — CID 9136842
naphthalen-1-ylmethyl 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetate (PubChem CID 9136842) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is naphthalen-1-ylmethyl 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetate.
| Compound Name | naphthalen-1-ylmethyl 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 9136842 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | naphthalen-1-ylmethyl 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)acetate |
| SMILES | O=C(Cn1c(=O)ccn(Cc2ccccc2)c1=O)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C24H20N2O4/c27-22-13-14-25(15-18-7-2-1-3-8-18)24(29)26(22)16-23(28)30-17-20-11-6-10-19-9-4-5-12-21(19)20/h1-14H,15-17H2 |
| InChIKey | SAWJEPONWQTTFF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |