C21H21N3O3 — CID 17498072
2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(4-ethylphenyl)acetamide (PubChem CID 17498072) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 17498072 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)Cn2c(=O)ccn(Cc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C21H21N3O3/c1-2-16-8-10-18(11-9-16)22-19(25)15-24-20(26)12-13-23(21(24)27)14-17-6-4-3-5-7-17/h3-13H,2,14-15H2,1H3,(H,22,25) |
| InChIKey | UYRJUCNUYKHURK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |