C22H23N3O3 — CID 29353373
2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(3-phenylpropyl)acetamide (PubChem CID 29353373) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 29353373 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(Cn1c(=O)ccn(Cc2ccccc2)c1=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c26-20(23-14-7-12-18-8-3-1-4-9-18)17-25-21(27)13-15-24(22(25)28)16-19-10-5-2-6-11-19/h1-6,8-11,13,15H,7,12,14,16-17H2,(H,23,26) |
| InChIKey | LIXBIDOAVWMEOB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|