C19H25N5O3 — CID 119447338
2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(2-piperazin-1-ylethyl)acetamide (PubChem CID 119447338) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(2-piperazin-1-ylethyl)acetamide.
| Compound Name | 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(2-piperazin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 119447338 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-(3-benzyl-2,6-dioxopyrimidin-1-yl)-N-(2-piperazin-1-ylethyl)acetamide |
| SMILES | O=C(Cn1c(=O)ccn(Cc2ccccc2)c1=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C19H25N5O3/c25-17(21-9-13-22-11-7-20-8-12-22)15-24-18(26)6-10-23(19(24)27)14-16-4-2-1-3-5-16/h1-6,10,20H,7-9,11-15H2,(H,21,25) |
| InChIKey | JKOZDEALXFLGRT-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |