C25H19NO6 — CID 1310453
benzyl 1,3-dioxo-2-(2-oxo-2-phenylmethoxyethyl)isoindole-5-carboxylate (PubChem CID 1310453) has the molecular formula C25H19NO6 and a molecular weight of 429.43 g/mol. Its IUPAC name is benzyl 1,3-dioxo-2-(2-oxo-2-phenylmethoxyethyl)isoindole-5-carboxylate.
| Compound Name | benzyl 1,3-dioxo-2-(2-oxo-2-phenylmethoxyethyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 1310453 |
| Molecular Formula | C25H19NO6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | benzyl 1,3-dioxo-2-(2-oxo-2-phenylmethoxyethyl)isoindole-5-carboxylate |
| SMILES | O=C(CN1C(=O)c2ccc(C(=O)OCc3ccccc3)cc2C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H19NO6/c27-22(31-15-17-7-3-1-4-8-17)14-26-23(28)20-12-11-19(13-21(20)24(26)29)25(30)32-16-18-9-5-2-6-10-18/h1-13H,14-16H2 |
| InChIKey | XFYNZHCPEDZWQD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|