C24H16N2O4 — CID 7738679
(3-cyanophenyl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7738679) has the molecular formula C24H16N2O4 and a molecular weight of 396.40 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3-cyanophenyl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7738679 |
| Molecular Formula | C24H16N2O4 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (3-cyanophenyl)methyl 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | N#Cc1cccc(COC(=O)c2ccc3c(c2)C(=O)N(Cc2ccccc2)C3=O)c1 |
| InChI | InChI=1S/C24H16N2O4/c25-13-17-7-4-8-18(11-17)15-30-24(29)19-9-10-20-21(12-19)23(28)26(22(20)27)14-16-5-2-1-3-6-16/h1-12H,14-15H2 |
| InChIKey | RURPHJBZTXHURX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|