C20H14N2O4 — CID 7359816
(3-cyanophenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 7359816) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | (3-cyanophenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7359816 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (3-cyanophenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)OCc3cccc(C#N)c3)cc2C1=O |
| InChI | InChI=1S/C20H14N2O4/c1-2-8-22-18(23)16-7-6-15(10-17(16)19(22)24)20(25)26-12-14-5-3-4-13(9-14)11-21/h2-7,9-10H,1,8,12H2 |
| InChIKey | AIHQUKWWSKXQGR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|