C20H17NO4 — CID 7359862
(2-methylphenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 7359862) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is (2-methylphenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | (2-methylphenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7359862 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (2-methylphenyl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)OCc3ccccc3C)cc2C1=O |
| InChI | InChI=1S/C20H17NO4/c1-3-10-21-18(22)16-9-8-14(11-17(16)19(21)23)20(24)25-12-15-7-5-4-6-13(15)2/h3-9,11H,1,10,12H2,2H3 |
| InChIKey | QKNNZUNCQZLPJY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|